C22H32N4O3 — CID 134090001
[3-(1,3-benzodioxol-5-ylmethyl)-3-methylpiperidin-1-yl]-(5-methyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-3-yl)methanone (PubChem CID 134090001) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is [3-(1,3-benzodioxol-5-ylmethyl)-3-methylpiperidin-1-yl]-(5-methyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-3-yl)methanone.
| Compound Name | [3-(1,3-benzodioxol-5-ylmethyl)-3-methylpiperidin-1-yl]-(5-methyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 134090001 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | [3-(1,3-benzodioxol-5-ylmethyl)-3-methylpiperidin-1-yl]-(5-methyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-3-yl)methanone |
| SMILES | CN1CCC2NNC(C(=O)N3CCCC(C)(Cc4ccc5c(c4)OCO5)C3)C2C1 |
| InChI | InChI=1S/C22H32N4O3/c1-22(11-15-4-5-18-19(10-15)29-14-28-18)7-3-8-26(13-22)21(27)20-16-12-25(2)9-6-17(16)23-24-20/h4-5,10,16-17,20,23-24H,3,6-9,11-14H2,1-2H3 |
| InChIKey | ZOGVEOWKOFOHOB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |