C9H17NOS — CID 134090286
2-hexyl-1,3-thiazolidin-4-one (PubChem CID 134090286) has the molecular formula C9H17NOS and a molecular weight of 187.31 g/mol. Its IUPAC name is 2-hexyl-1,3-thiazolidin-4-one.
| Compound Name | 2-hexyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 134090286 |
| Molecular Formula | C9H17NOS |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 2-hexyl-1,3-thiazolidin-4-one |
| SMILES | CCCCCCC1NC(=O)CS1 |
| InChI | InChI=1S/C9H17NOS/c1-2-3-4-5-6-9-10-8(11)7-12-9/h9H,2-7H2,1H3,(H,10,11) |
| InChIKey | CKJFHBBOOBJDQY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|