C16H10FN3O5S — CID 134092963
N-(4-fluoro-1,3-dioxoisoindol-2-yl)-2-(4-nitrophenyl)sulfanylacetamide (PubChem CID 134092963) has the molecular formula C16H10FN3O5S and a molecular weight of 375.34 g/mol. Its IUPAC name is N-(4-fluoro-1,3-dioxoisoindol-2-yl)-2-(4-nitrophenyl)sulfanylacetamide.
| Compound Name | N-(4-fluoro-1,3-dioxoisoindol-2-yl)-2-(4-nitrophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 134092963 |
| Molecular Formula | C16H10FN3O5S |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | N-(4-fluoro-1,3-dioxoisoindol-2-yl)-2-(4-nitrophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1ccc([N+](=O)[O-])cc1)NN1C(=O)c2cccc(F)c2C1=O |
| InChI | InChI=1S/C16H10FN3O5S/c17-12-3-1-2-11-14(12)16(23)19(15(11)22)18-13(21)8-26-10-6-4-9(5-7-10)20(24)25/h1-7H,8H2,(H,18,21) |
| InChIKey | MANVHEPVYDGPFG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|