C15H15BrO3 — CID 134093010
(3E)-3-[(5-bromo-2,2-dimethyl-3H-1-benzofuran-7-yl)methylidene]oxolan-2-one (PubChem CID 134093010) has the molecular formula C15H15BrO3 and a molecular weight of 323.19 g/mol. Its IUPAC name is (3E)-3-[(5-bromo-2,2-dimethyl-3H-1-benzofuran-7-yl)methylidene]oxolan-2-one.
| Compound Name | (3E)-3-[(5-bromo-2,2-dimethyl-3H-1-benzofuran-7-yl)methylidene]oxolan-2-one |
|---|---|
| PubChem CID | 134093010 |
| Molecular Formula | C15H15BrO3 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | (3E)-3-[(5-bromo-2,2-dimethyl-3H-1-benzofuran-7-yl)methylidene]oxolan-2-one |
| SMILES | CC1(C)Cc2cc(Br)cc(/C=C3\CCOC3=O)c2O1 |
| InChI | InChI=1S/C15H15BrO3/c1-15(2)8-11-7-12(16)6-10(13(11)19-15)5-9-3-4-18-14(9)17/h5-7H,3-4,8H2,1-2H3/b9-5+ |
| InChIKey | DFDVJBIMXVVDDZ-WEVVVXLNSA-N |
| XLogP | 3.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|