C17H14F6INO2 — CID 134094749
1-(1-methylpyridin-1-ium-3-yl)ethyl 3,5-bis(trifluoromethyl)benzoate iodide (PubChem CID 134094749) has the molecular formula C17H14F6INO2 and a molecular weight of 505.20 g/mol. Its IUPAC name is 1-(1-methylpyridin-1-ium-3-yl)ethyl 3,5-bis(trifluoromethyl)benzoate iodide.
| Compound Name | 1-(1-methylpyridin-1-ium-3-yl)ethyl 3,5-bis(trifluoromethyl)benzoate iodide |
|---|---|
| PubChem CID | 134094749 |
| Molecular Formula | C17H14F6INO2 |
| Molecular Weight | 505.20 g/mol |
| Exact Mass | 505.00 |
| IUPAC Name | 1-(1-methylpyridin-1-ium-3-yl)ethyl 3,5-bis(trifluoromethyl)benzoate iodide |
| SMILES | CC(OC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc[n+](C)c1.[I-] |
| InChI | InChI=1S/C17H14F6NO2.HI/c1-10(11-4-3-5-24(2)9-11)26-15(25)12-6-13(16(18,19)20)8-14(7-12)17(21,22)23;/h3-10H,1-2H3;1H/q+1;/p-1 |
| InChIKey | FMYCXJZOKUWSJS-UHFFFAOYSA-M |
| XLogP | 1.47 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|