C18H12N4O6S2 — CID 134094865
2-[[4-amino-5-(4-nitrobenzoyl)-1,3-thiazol-2-yl]sulfanyl]-1-(4-nitrophenyl)ethanone (PubChem CID 134094865) has the molecular formula C18H12N4O6S2 and a molecular weight of 444.45 g/mol. Its IUPAC name is 2-[[4-amino-5-(4-nitrobenzoyl)-1,3-thiazol-2-yl]sulfanyl]-1-(4-nitrophenyl)ethanone.
| Compound Name | 2-[[4-amino-5-(4-nitrobenzoyl)-1,3-thiazol-2-yl]sulfanyl]-1-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 134094865 |
| Molecular Formula | C18H12N4O6S2 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | 2-[[4-amino-5-(4-nitrobenzoyl)-1,3-thiazol-2-yl]sulfanyl]-1-(4-nitrophenyl)ethanone |
| SMILES | Nc1nc(SCC(=O)c2ccc([N+](=O)[O-])cc2)sc1C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H12N4O6S2/c19-17-16(15(24)11-3-7-13(8-4-11)22(27)28)30-18(20-17)29-9-14(23)10-1-5-12(6-2-10)21(25)26/h1-8H,9,19H2 |
| InChIKey | FIYOVQBDMPZAKV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 159.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|