C15H16N4O5S — CID 20590567
methyl 2-[[4-amino-5-(4-nitrobenzoyl)-1,3-thiazol-2-yl]amino]butanoate (PubChem CID 20590567) has the molecular formula C15H16N4O5S and a molecular weight of 364.38 g/mol. Its IUPAC name is methyl 2-[[4-amino-5-(4-nitrobenzoyl)-1,3-thiazol-2-yl]amino]butanoate.
| Compound Name | methyl 2-[[4-amino-5-(4-nitrobenzoyl)-1,3-thiazol-2-yl]amino]butanoate |
|---|---|
| PubChem CID | 20590567 |
| Molecular Formula | C15H16N4O5S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | methyl 2-[[4-amino-5-(4-nitrobenzoyl)-1,3-thiazol-2-yl]amino]butanoate |
| SMILES | CCC(Nc1nc(N)c(C(=O)c2ccc([N+](=O)[O-])cc2)s1)C(=O)OC |
| InChI | InChI=1S/C15H16N4O5S/c1-3-10(14(21)24-2)17-15-18-13(16)12(25-15)11(20)8-4-6-9(7-5-8)19(22)23/h4-7,10H,3,16H2,1-2H3,(H,17,18) |
| InChIKey | GRKYSEZMIPCMGQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 137.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|