C14H16N4O2S — CID 134096713
3-(phenylcarbamoylamino)-5-propan-2-yl-1,2-thiazole-4-carboxamide (PubChem CID 134096713) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 3-(phenylcarbamoylamino)-5-propan-2-yl-1,2-thiazole-4-carboxamide.
| Compound Name | 3-(phenylcarbamoylamino)-5-propan-2-yl-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 134096713 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 3-(phenylcarbamoylamino)-5-propan-2-yl-1,2-thiazole-4-carboxamide |
| SMILES | CC(C)c1snc(NC(=O)Nc2ccccc2)c1C(N)=O |
| InChI | InChI=1S/C14H16N4O2S/c1-8(2)11-10(12(15)19)13(18-21-11)17-14(20)16-9-6-4-3-5-7-9/h3-8H,1-2H3,(H2,15,19)(H2,16,17,18,20) |
| InChIKey | SEBVQNYZZOJXPO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |