C3H6NaO5PS — CID 134096910
sodium carboxymethylsulfanylmethyl(hydroxy)phosphinate (PubChem CID 134096910) has the molecular formula C3H6NaO5PS and a molecular weight of 208.11 g/mol. Its IUPAC name is sodium carboxymethylsulfanylmethyl(hydroxy)phosphinate.
| Compound Name | sodium carboxymethylsulfanylmethyl(hydroxy)phosphinate |
|---|---|
| PubChem CID | 134096910 |
| Molecular Formula | C3H6NaO5PS |
| Molecular Weight | 208.11 g/mol |
| Exact Mass | 207.96 |
| IUPAC Name | sodium carboxymethylsulfanylmethyl(hydroxy)phosphinate |
| SMILES | O=C(O)CSCP(=O)([O-])O.[Na+] |
| InChI | InChI=1S/C3H7O5PS.Na/c4-3(5)1-10-2-9(6,7)8;/h1-2H2,(H,4,5)(H2,6,7,8);/q;+1/p-1 |
| InChIKey | CXTIVCCYCLCPQN-UHFFFAOYSA-M |
| XLogP | -3.69 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.11 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|