C10H10Cl2N4S — CID 134097079
3-(2,6-dichloro-4-pyridinyl)-4-propyl-1H-1,2,4-triazole-5-thione (PubChem CID 134097079) has the molecular formula C10H10Cl2N4S and a molecular weight of 289.19 g/mol. Its IUPAC name is 3-(2,6-dichloro-4-pyridinyl)-4-propyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2,6-dichloro-4-pyridinyl)-4-propyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 134097079 |
| Molecular Formula | C10H10Cl2N4S |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 3-(2,6-dichloro-4-pyridinyl)-4-propyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCn1c(-c2cc(Cl)nc(Cl)c2)n[nH]c1=S |
| InChI | InChI=1S/C10H10Cl2N4S/c1-2-3-16-9(14-15-10(16)17)6-4-7(11)13-8(12)5-6/h4-5H,2-3H2,1H3,(H,15,17) |
| InChIKey | UKEGLKZPCHZRLE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|