About [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-(5-methylthiophen-2-yl)methanol
[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-(5-methylthiophen-2-yl)methanol (PubChem CID 134099934) has the molecular formula C17H19NO2S
and a molecular weight of 301.41 g/mol. Its IUPAC name is [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-(5-methylthiophen-2-yl)methanol.
Molecular Properties
| Compound Name | [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-(5-methylthiophen-2-yl)methanol |
| PubChem CID | 134099934 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-(5-methylthiophen-2-yl)methanol |
| SMILES | Cc1ccc(C(O)c2ccc(C3=NC(C)(C)CO3)cc2)s1 |
| InChI | InChI=1S/C17H19NO2S/c1-11-4-9-14(21-11)15(19)12-5-7-13(8-6-12)16-18-17(2,3)10-20-16/h4-9,15,19H,10H2,1-3H3 |
| InChIKey | MFYXRVASBQZTGI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-(5-methylthiophen-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-(5-methylthiophen-2-yl)methanol?
The IUPAC name of [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-(5-methylthiophen-2-yl)methanol (CID 134099934) is [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-(5-methylthiophen-2-yl)methanol.
What is the SMILES notation for [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-(5-methylthiophen-2-yl)methanol?
The canonical SMILES for [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-(5-methylthiophen-2-yl)methanol is Cc1ccc(C(O)c2ccc(C3=NC(C)(C)CO3)cc2)s1.
What is the InChIKey of [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-(5-methylthiophen-2-yl)methanol?
The InChIKey is MFYXRVASBQZTGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2S/c1-11-4-9-14(21-11)15(19)12-5-7-13(8-6-12)16-18-17(2,3)10-20-16/h4-9,15,19H,10H2,1-3H3.
What are the key properties of [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-(5-methylthiophen-2-yl)methanol?
[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-(5-methylthiophen-2-yl)methanol has a molecular weight of 301.41 g/mol, XLogP of 3.69, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-(5-methylthiophen-2-yl)methanol is sourced from PubChem (CID 134099934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).