C10H12N2O2 — CID 134100901
2-(2-methylbenzimidazol-1-yl)ethane-1,1-diol (PubChem CID 134100901) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-(2-methylbenzimidazol-1-yl)ethane-1,1-diol.
| Compound Name | 2-(2-methylbenzimidazol-1-yl)ethane-1,1-diol |
|---|---|
| PubChem CID | 134100901 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-(2-methylbenzimidazol-1-yl)ethane-1,1-diol |
| SMILES | Cc1nc2ccccc2n1CC(O)O |
| InChI | InChI=1S/C10H12N2O2/c1-7-11-8-4-2-3-5-9(8)12(7)6-10(13)14/h2-5,10,13-14H,6H2,1H3 |
| InChIKey | RXLOBFQXDLRIDK-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|