C12H16N2O2 — CID 66222131
1-(2,2-dimethoxyethyl)-2-methylbenzimidazole (PubChem CID 66222131) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-2-methylbenzimidazole.
| Compound Name | 1-(2,2-dimethoxyethyl)-2-methylbenzimidazole |
|---|---|
| PubChem CID | 66222131 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-2-methylbenzimidazole |
| SMILES | COC(Cn1c(C)nc2ccccc21)OC |
| InChI | InChI=1S/C12H16N2O2/c1-9-13-10-6-4-5-7-11(10)14(9)8-12(15-2)16-3/h4-7,12H,8H2,1-3H3 |
| InChIKey | ZCFFFVSNLGOJIK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|