About [3-(2-methylimidazo[1,2-a]pyridin-3-yl)pyrazol-1-yl]-phenylmethanone
[3-(2-methylimidazo[1,2-a]pyridin-3-yl)pyrazol-1-yl]-phenylmethanone (PubChem CID 134101749) has the molecular formula C18H14N4O
and a molecular weight of 302.34 g/mol. Its IUPAC name is [3-(2-methylimidazo[1,2-a]pyridin-3-yl)pyrazol-1-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [3-(2-methylimidazo[1,2-a]pyridin-3-yl)pyrazol-1-yl]-phenylmethanone |
| PubChem CID | 134101749 |
| Molecular Formula | C18H14N4O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | [3-(2-methylimidazo[1,2-a]pyridin-3-yl)pyrazol-1-yl]-phenylmethanone |
| SMILES | Cc1nc2ccccn2c1-c1ccn(C(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C18H14N4O/c1-13-17(21-11-6-5-9-16(21)19-13)15-10-12-22(20-15)18(23)14-7-3-2-4-8-14/h2-12H,1H3 |
| InChIKey | ORWZYLKFJYLENF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(2-methylimidazo[1,2-a]pyridin-3-yl)pyrazol-1-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-methylimidazo[1,2-a]pyridin-3-yl)pyrazol-1-yl]-phenylmethanone?
The IUPAC name of [3-(2-methylimidazo[1,2-a]pyridin-3-yl)pyrazol-1-yl]-phenylmethanone (CID 134101749) is [3-(2-methylimidazo[1,2-a]pyridin-3-yl)pyrazol-1-yl]-phenylmethanone.
What is the SMILES notation for [3-(2-methylimidazo[1,2-a]pyridin-3-yl)pyrazol-1-yl]-phenylmethanone?
The canonical SMILES for [3-(2-methylimidazo[1,2-a]pyridin-3-yl)pyrazol-1-yl]-phenylmethanone is Cc1nc2ccccn2c1-c1ccn(C(=O)c2ccccc2)n1.
What is the InChIKey of [3-(2-methylimidazo[1,2-a]pyridin-3-yl)pyrazol-1-yl]-phenylmethanone?
The InChIKey is ORWZYLKFJYLENF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N4O/c1-13-17(21-11-6-5-9-16(21)19-13)15-10-12-22(20-15)18(23)14-7-3-2-4-8-14/h2-12H,1H3.
What are the key properties of [3-(2-methylimidazo[1,2-a]pyridin-3-yl)pyrazol-1-yl]-phenylmethanone?
[3-(2-methylimidazo[1,2-a]pyridin-3-yl)pyrazol-1-yl]-phenylmethanone has a molecular weight of 302.34 g/mol, XLogP of 3.19, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-methylimidazo[1,2-a]pyridin-3-yl)pyrazol-1-yl]-phenylmethanone is sourced from PubChem (CID 134101749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).