C22H27ClN2O2 — CID 134103027
1-[2-(4-butoxy-3-chlorophenyl)ethoxy]-2,4,6-trimethylbenzimidazole (PubChem CID 134103027) has the molecular formula C22H27ClN2O2 and a molecular weight of 386.92 g/mol. Its IUPAC name is 1-[2-(4-butoxy-3-chlorophenyl)ethoxy]-2,4,6-trimethylbenzimidazole.
| Compound Name | 1-[2-(4-butoxy-3-chlorophenyl)ethoxy]-2,4,6-trimethylbenzimidazole |
|---|---|
| PubChem CID | 134103027 |
| Molecular Formula | C22H27ClN2O2 |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 1-[2-(4-butoxy-3-chlorophenyl)ethoxy]-2,4,6-trimethylbenzimidazole |
| SMILES | CCCCOc1ccc(CCOn2c(C)nc3c(C)cc(C)cc32)cc1Cl |
| InChI | InChI=1S/C22H27ClN2O2/c1-5-6-10-26-21-8-7-18(14-19(21)23)9-11-27-25-17(4)24-22-16(3)12-15(2)13-20(22)25/h7-8,12-14H,5-6,9-11H2,1-4H3 |
| InChIKey | YGCPCIVDSGFDBX-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|