C22H26N4O — CID 134115708
2-butoxy-5-[2-[(2,4-dimethylbenzimidazol-1-yl)amino]ethyl]benzonitrile (PubChem CID 134115708) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is 2-butoxy-5-[2-[(2,4-dimethylbenzimidazol-1-yl)amino]ethyl]benzonitrile.
| Compound Name | 2-butoxy-5-[2-[(2,4-dimethylbenzimidazol-1-yl)amino]ethyl]benzonitrile |
|---|---|
| PubChem CID | 134115708 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 2-butoxy-5-[2-[(2,4-dimethylbenzimidazol-1-yl)amino]ethyl]benzonitrile |
| SMILES | CCCCOc1ccc(CCNn2c(C)nc3c(C)cccc32)cc1C#N |
| InChI | InChI=1S/C22H26N4O/c1-4-5-13-27-21-10-9-18(14-19(21)15-23)11-12-24-26-17(3)25-22-16(2)7-6-8-20(22)26/h6-10,14,24H,4-5,11-13H2,1-3H3 |
| InChIKey | OGLXJSVUVBWFBB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 62.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|