C20H33N2O3+ — CID 143486220
[2-amino-4-(3-cyano-4-octoxyphenyl)-2-(hydroxymethyl)butyl]oxidanium (PubChem CID 143486220) has the molecular formula C20H33N2O3+ and a molecular weight of 349.50 g/mol. Its IUPAC name is [2-amino-4-(3-cyano-4-octoxyphenyl)-2-(hydroxymethyl)butyl]oxidanium.
| Compound Name | [2-amino-4-(3-cyano-4-octoxyphenyl)-2-(hydroxymethyl)butyl]oxidanium |
|---|---|
| PubChem CID | 143486220 |
| Molecular Formula | C20H33N2O3+ |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | [2-amino-4-(3-cyano-4-octoxyphenyl)-2-(hydroxymethyl)butyl]oxidanium |
| SMILES | CCCCCCCCOc1ccc(CCC(N)(CO)C[OH2+])cc1C#N |
| InChI | InChI=1S/C20H32N2O3/c1-2-3-4-5-6-7-12-25-19-9-8-17(13-18(19)14-21)10-11-20(22,15-23)16-24/h8-9,13,23-24H,2-7,10-12,15-16,22H2,1H3/p+1 |
| InChIKey | QZSMUBIJQAOUTC-UHFFFAOYSA-O |
| XLogP | 2.64 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|