C22H28N2O3 — CID 59407522
5-[3-amino-4-hydroxy-3-(hydroxymethyl)butyl]-2-[3-(3-methylphenyl)propoxy]benzonitrile (PubChem CID 59407522) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 5-[3-amino-4-hydroxy-3-(hydroxymethyl)butyl]-2-[3-(3-methylphenyl)propoxy]benzonitrile.
| Compound Name | 5-[3-amino-4-hydroxy-3-(hydroxymethyl)butyl]-2-[3-(3-methylphenyl)propoxy]benzonitrile |
|---|---|
| PubChem CID | 59407522 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 5-[3-amino-4-hydroxy-3-(hydroxymethyl)butyl]-2-[3-(3-methylphenyl)propoxy]benzonitrile |
| SMILES | Cc1cccc(CCCOc2ccc(CCC(N)(CO)CO)cc2C#N)c1 |
| InChI | InChI=1S/C22H28N2O3/c1-17-4-2-5-18(12-17)6-3-11-27-21-8-7-19(13-20(21)14-23)9-10-22(24,15-25)16-26/h2,4-5,7-8,12-13,25-26H,3,6,9-11,15-16,24H2,1H3 |
| InChIKey | LZJMLMBLPFZEPO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|