C20H32N2O4P+ — CID 173070375
[2-amino-4-(3-cyano-4-octoxyphenyl)-2-(hydroxymethyl)butoxy]-oxophosphanium (PubChem CID 173070375) has the molecular formula C20H32N2O4P+ and a molecular weight of 395.46 g/mol. Its IUPAC name is [2-amino-4-(3-cyano-4-octoxyphenyl)-2-(hydroxymethyl)butoxy]-oxophosphanium.
| Compound Name | [2-amino-4-(3-cyano-4-octoxyphenyl)-2-(hydroxymethyl)butoxy]-oxophosphanium |
|---|---|
| PubChem CID | 173070375 |
| Molecular Formula | C20H32N2O4P+ |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | [2-amino-4-(3-cyano-4-octoxyphenyl)-2-(hydroxymethyl)butoxy]-oxophosphanium |
| SMILES | CCCCCCCCOc1ccc(CCC(N)(CO)CO[PH+]=O)cc1C#N |
| InChI | InChI=1S/C20H32N2O4P/c1-2-3-4-5-6-7-12-25-19-9-8-17(13-18(19)14-21)10-11-20(22,15-23)16-26-27-24/h8-9,13,23,27H,2-7,10-12,15-16,22H2,1H3/q+1 |
| InChIKey | MOMLFWOXLQGDQT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 105.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|