C13H23N2+ — CID 134103531
1-butyl-2,3,5,6,7,8-hexahydroquinolin-1-ium-4-amine (PubChem CID 134103531) has the molecular formula C13H23N2+ and a molecular weight of 207.34 g/mol. Its IUPAC name is 1-butyl-2,3,5,6,7,8-hexahydroquinolin-1-ium-4-amine.
| Compound Name | 1-butyl-2,3,5,6,7,8-hexahydroquinolin-1-ium-4-amine |
|---|---|
| PubChem CID | 134103531 |
| Molecular Formula | C13H23N2+ |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.19 |
| IUPAC Name | 1-butyl-2,3,5,6,7,8-hexahydroquinolin-1-ium-4-amine |
| SMILES | CCCC[N+]1=C2CCCCC2=C(N)CC1 |
| InChI | InChI=1S/C13H22N2/c1-2-3-9-15-10-8-12(14)11-6-4-5-7-13(11)15/h14H,2-10H2,1H3/p+1 |
| InChIKey | XXGRZWMCAIPBOH-UHFFFAOYSA-O |
| XLogP | 2.43 |
| TPSA | 29.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|