C21H24N+ — CID 135006915
(4Z)-4-benzylidene-1-butyl-5-phenyl-2,3-dihydropyrrol-1-ium (PubChem CID 135006915) has the molecular formula C21H24N+ and a molecular weight of 290.43 g/mol. Its IUPAC name is (4Z)-4-benzylidene-1-butyl-5-phenyl-2,3-dihydropyrrol-1-ium.
| Compound Name | (4Z)-4-benzylidene-1-butyl-5-phenyl-2,3-dihydropyrrol-1-ium |
|---|---|
| PubChem CID | 135006915 |
| Molecular Formula | C21H24N+ |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (4Z)-4-benzylidene-1-butyl-5-phenyl-2,3-dihydropyrrol-1-ium |
| SMILES | CCCC[N+]1=C(c2ccccc2)/C(=C\c2ccccc2)CC1 |
| InChI | InChI=1S/C21H24N/c1-2-3-15-22-16-14-20(17-18-10-6-4-7-11-18)21(22)19-12-8-5-9-13-19/h4-13,17H,2-3,14-16H2,1H3/q+1/b20-17- |
| InChIKey | HUUBWNMYSABLLI-JZJYNLBNSA-N |
| XLogP | 4.78 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|