C21H26N2 — CID 134103725
1-(2,3,4,5,6-pentamethylphenyl)-N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]methanamine (PubChem CID 134103725) has the molecular formula C21H26N2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentamethylphenyl)-N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]methanamine.
| Compound Name | 1-(2,3,4,5,6-pentamethylphenyl)-N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]methanamine |
|---|---|
| PubChem CID | 134103725 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 1-(2,3,4,5,6-pentamethylphenyl)-N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]methanamine |
| SMILES | Cc1c(C)c(C)c(CN/N=C/C=C/c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C21H26N2/c1-15-16(2)18(4)21(19(5)17(15)3)14-23-22-13-9-12-20-10-7-6-8-11-20/h6-13,23H,14H2,1-5H3/b12-9+,22-13+ |
| InChIKey | GNYPEKOXVGEHQA-OGCVIRRGSA-N |
| XLogP | 5.02 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|