C20H28ClNO2 — CID 134105469
2-[2-(dimethylamino)ethyl]-3-methyl-2-naphthalen-1-ylpentanoic acid;hydrochloride (PubChem CID 134105469) has the molecular formula C20H28ClNO2 and a molecular weight of 349.90 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl]-3-methyl-2-naphthalen-1-ylpentanoic acid;hydrochloride.
| Compound Name | 2-[2-(dimethylamino)ethyl]-3-methyl-2-naphthalen-1-ylpentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 134105469 |
| Molecular Formula | C20H28ClNO2 |
| Molecular Weight | 349.90 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl]-3-methyl-2-naphthalen-1-ylpentanoic acid;hydrochloride |
| SMILES | CCC(C)C(CCN(C)C)(C(=O)O)c1cccc2ccccc12.Cl |
| InChI | InChI=1S/C20H27NO2.ClH/c1-5-15(2)20(19(22)23,13-14-21(3)4)18-12-8-10-16-9-6-7-11-17(16)18;/h6-12,15H,5,13-14H2,1-4H3,(H,22,23);1H |
| InChIKey | BEXXJRJGDYLPNM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.90 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |