C22H30ClNO3 — CID 20978089
3-methyl-2-(1-morpholin-4-ylethyl)-2-naphthalen-1-ylpentanoic acid;hydrochloride (PubChem CID 20978089) has the molecular formula C22H30ClNO3 and a molecular weight of 391.94 g/mol. Its IUPAC name is 3-methyl-2-(1-morpholin-4-ylethyl)-2-naphthalen-1-ylpentanoic acid;hydrochloride.
| Compound Name | 3-methyl-2-(1-morpholin-4-ylethyl)-2-naphthalen-1-ylpentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 20978089 |
| Molecular Formula | C22H30ClNO3 |
| Molecular Weight | 391.94 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 3-methyl-2-(1-morpholin-4-ylethyl)-2-naphthalen-1-ylpentanoic acid;hydrochloride |
| SMILES | CCC(C)C(C(=O)O)(c1cccc2ccccc12)C(C)N1CCOCC1.Cl |
| InChI | InChI=1S/C22H29NO3.ClH/c1-4-16(2)22(21(24)25,17(3)23-12-14-26-15-13-23)20-11-7-9-18-8-5-6-10-19(18)20;/h5-11,16-17H,4,12-15H2,1-3H3,(H,24,25);1H |
| InChIKey | ABHMGYFMOSUWTB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.94 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |