C7H9Cl3O5 — CID 134105966
methyl (2Z)-4,4,4-trichloro-3-hydroxy-2-[hydroxy(methoxy)methylidene]butanoate (PubChem CID 134105966) has the molecular formula C7H9Cl3O5 and a molecular weight of 279.50 g/mol. Its IUPAC name is methyl (2Z)-4,4,4-trichloro-3-hydroxy-2-[hydroxy(methoxy)methylidene]butanoate.
| Compound Name | methyl (2Z)-4,4,4-trichloro-3-hydroxy-2-[hydroxy(methoxy)methylidene]butanoate |
|---|---|
| PubChem CID | 134105966 |
| Molecular Formula | C7H9Cl3O5 |
| Molecular Weight | 279.50 g/mol |
| Exact Mass | 277.95 |
| IUPAC Name | methyl (2Z)-4,4,4-trichloro-3-hydroxy-2-[hydroxy(methoxy)methylidene]butanoate |
| SMILES | COC(=O)/C(=C(/O)OC)C(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H9Cl3O5/c1-14-5(12)3(6(13)15-2)4(11)7(8,9)10/h4,11-12H,1-2H3/b5-3- |
| InChIKey | YHAQQIYWVSFSJI-HYXAFXHYSA-N |
| XLogP | 1.31 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.50 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|