C10H14O8 — CID 134096248
trimethyl (Z)-3-hydroxy-3-methoxyprop-2-ene-1,1,2-tricarboxylate (PubChem CID 134096248) has the molecular formula C10H14O8 and a molecular weight of 262.21 g/mol. Its IUPAC name is trimethyl (Z)-3-hydroxy-3-methoxyprop-2-ene-1,1,2-tricarboxylate.
| Compound Name | trimethyl (Z)-3-hydroxy-3-methoxyprop-2-ene-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 134096248 |
| Molecular Formula | C10H14O8 |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | trimethyl (Z)-3-hydroxy-3-methoxyprop-2-ene-1,1,2-tricarboxylate |
| SMILES | COC(=O)/C(=C(/O)OC)C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C10H14O8/c1-15-7(11)5(8(12)16-2)6(9(13)17-3)10(14)18-4/h5,13H,1-4H3/b9-6- |
| InChIKey | BSFLBDMVAFZYGW-TWGQIWQCSA-N |
| XLogP | -0.46 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|