C14H22O8 — CID 11056233
trimethyl (E)-4-(methoxymethoxy)-3-methylpent-2-ene-1,1,2-tricarboxylate (PubChem CID 11056233) has the molecular formula C14H22O8 and a molecular weight of 318.32 g/mol. Its IUPAC name is trimethyl (E)-4-(methoxymethoxy)-3-methylpent-2-ene-1,1,2-tricarboxylate.
| Compound Name | trimethyl (E)-4-(methoxymethoxy)-3-methylpent-2-ene-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 11056233 |
| Molecular Formula | C14H22O8 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | trimethyl (E)-4-(methoxymethoxy)-3-methylpent-2-ene-1,1,2-tricarboxylate |
| SMILES | COCOC(C)/C(C)=C(/C(=O)OC)C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C14H22O8/c1-8(9(2)22-7-18-3)10(12(15)19-4)11(13(16)20-5)14(17)21-6/h9,11H,7H2,1-6H3/b10-8+ |
| InChIKey | AKDBMKRQNIFQKP-CSKARUKUSA-N |
| XLogP | 0.45 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|