About (E)-5-(methoxymethoxy)-3,4-dimethylhex-3-en-1-ol
(E)-5-(methoxymethoxy)-3,4-dimethylhex-3-en-1-ol (PubChem CID 10976246) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is (E)-5-(methoxymethoxy)-3,4-dimethylhex-3-en-1-ol.
Molecular Properties
| Compound Name | (E)-5-(methoxymethoxy)-3,4-dimethylhex-3-en-1-ol |
| PubChem CID | 10976246 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | (E)-5-(methoxymethoxy)-3,4-dimethylhex-3-en-1-ol |
| SMILES | COCOC(C)/C(C)=C(\C)CCO |
| InChI | InChI=1S/C10H20O3/c1-8(5-6-11)9(2)10(3)13-7-12-4/h10-11H,5-7H2,1-4H3/b9-8+ |
| InChIKey | AZHBAZGKUYIDCJ-CMDGGOBGSA-N |
| XLogP | 1.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-(methoxymethoxy)-3,4-dimethylhex-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-(methoxymethoxy)-3,4-dimethylhex-3-en-1-ol?
The IUPAC name of (E)-5-(methoxymethoxy)-3,4-dimethylhex-3-en-1-ol (CID 10976246) is (E)-5-(methoxymethoxy)-3,4-dimethylhex-3-en-1-ol.
What is the SMILES notation for (E)-5-(methoxymethoxy)-3,4-dimethylhex-3-en-1-ol?
The canonical SMILES for (E)-5-(methoxymethoxy)-3,4-dimethylhex-3-en-1-ol is COCOC(C)/C(C)=C(\C)CCO.
What is the InChIKey of (E)-5-(methoxymethoxy)-3,4-dimethylhex-3-en-1-ol?
The InChIKey is AZHBAZGKUYIDCJ-CMDGGOBGSA-N. The full InChI is InChI=1S/C10H20O3/c1-8(5-6-11)9(2)10(3)13-7-12-4/h10-11H,5-7H2,1-4H3/b9-8+.
What are the key properties of (E)-5-(methoxymethoxy)-3,4-dimethylhex-3-en-1-ol?
(E)-5-(methoxymethoxy)-3,4-dimethylhex-3-en-1-ol has a molecular weight of 188.27 g/mol, XLogP of 1.71, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-(methoxymethoxy)-3,4-dimethylhex-3-en-1-ol is sourced from PubChem (CID 10976246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).