C10H20O3 — CID 10976246
(E)-5-(methoxymethoxy)-3,4-dimethylhex-3-en-1-ol (PubChem CID 10976246) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is (E)-5-(methoxymethoxy)-3,4-dimethylhex-3-en-1-ol.
| Compound Name | (E)-5-(methoxymethoxy)-3,4-dimethylhex-3-en-1-ol |
|---|---|
| PubChem CID | 10976246 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | (E)-5-(methoxymethoxy)-3,4-dimethylhex-3-en-1-ol |
| SMILES | COCOC(C)/C(C)=C(\C)CCO |
| InChI | InChI=1S/C10H20O3/c1-8(5-6-11)9(2)10(3)13-7-12-4/h10-11H,5-7H2,1-4H3/b9-8+ |
| InChIKey | AZHBAZGKUYIDCJ-CMDGGOBGSA-N |
| XLogP | 1.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|