C22H24FN5O — CID 134107288
[1-[[4-(2-ethyltetrazol-5-yl)phenyl]methyl]piperidin-4-yl]-(4-fluorophenyl)methanone (PubChem CID 134107288) has the molecular formula C22H24FN5O and a molecular weight of 393.47 g/mol. Its IUPAC name is [1-[[4-(2-ethyltetrazol-5-yl)phenyl]methyl]piperidin-4-yl]-(4-fluorophenyl)methanone.
| Compound Name | [1-[[4-(2-ethyltetrazol-5-yl)phenyl]methyl]piperidin-4-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 134107288 |
| Molecular Formula | C22H24FN5O |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | [1-[[4-(2-ethyltetrazol-5-yl)phenyl]methyl]piperidin-4-yl]-(4-fluorophenyl)methanone |
| SMILES | CCn1nnc(-c2ccc(CN3CCC(C(=O)c4ccc(F)cc4)CC3)cc2)n1 |
| InChI | InChI=1S/C22H24FN5O/c1-2-28-25-22(24-26-28)19-5-3-16(4-6-19)15-27-13-11-18(12-14-27)21(29)17-7-9-20(23)10-8-17/h3-10,18H,2,11-15H2,1H3 |
| InChIKey | DSTHBYKPTVUOOS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |