C20H21ClN6O — CID 134107698
6-N-[(3-chlorophenyl)methyl]-4-N-(2,3-dihydro-1H-inden-2-yl)-2-N-methoxy-1,3,5-triazine-2,4,6-triamine (PubChem CID 134107698) has the molecular formula C20H21ClN6O and a molecular weight of 396.88 g/mol. Its IUPAC name is 6-N-[(3-chlorophenyl)methyl]-4-N-(2,3-dihydro-1H-inden-2-yl)-2-N-methoxy-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-[(3-chlorophenyl)methyl]-4-N-(2,3-dihydro-1H-inden-2-yl)-2-N-methoxy-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 134107698 |
| Molecular Formula | C20H21ClN6O |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 6-N-[(3-chlorophenyl)methyl]-4-N-(2,3-dihydro-1H-inden-2-yl)-2-N-methoxy-1,3,5-triazine-2,4,6-triamine |
| SMILES | CONc1nc(NCc2cccc(Cl)c2)nc(NC2Cc3ccccc3C2)n1 |
| InChI | InChI=1S/C20H21ClN6O/c1-28-27-20-25-18(22-12-13-5-4-8-16(21)9-13)24-19(26-20)23-17-10-14-6-2-3-7-15(14)11-17/h2-9,17H,10-12H2,1H3,(H3,22,23,24,25,26,27) |
| InChIKey | AMWPFWRVHUYAMK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 83.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|