C23H29N7O2 — CID 134108275
N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-6-(3-phenylpropylamino)-1,3,5-triazin-2-yl]hydroxylamine (PubChem CID 134108275) has the molecular formula C23H29N7O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-6-(3-phenylpropylamino)-1,3,5-triazin-2-yl]hydroxylamine.
| Compound Name | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-6-(3-phenylpropylamino)-1,3,5-triazin-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 134108275 |
| Molecular Formula | C23H29N7O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-6-(3-phenylpropylamino)-1,3,5-triazin-2-yl]hydroxylamine |
| SMILES | COc1ccccc1N1CCN(c2nc(NO)nc(NCCCc3ccccc3)n2)CC1 |
| InChI | InChI=1S/C23H29N7O2/c1-32-20-12-6-5-11-19(20)29-14-16-30(17-15-29)23-26-21(25-22(27-23)28-31)24-13-7-10-18-8-3-2-4-9-18/h2-6,8-9,11-12,31H,7,10,13-17H2,1H3,(H2,24,25,26,27,28) |
| InChIKey | AXIGDPGLHKUUTI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 98.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|