C11H12F3N7O — CID 134108507
N-[4-(pyridin-3-ylmethylamino)-6-(2,2,2-trifluoroethylamino)-1,3,5-triazin-2-yl]hydroxylamine (PubChem CID 134108507) has the molecular formula C11H12F3N7O and a molecular weight of 315.26 g/mol. Its IUPAC name is N-[4-(pyridin-3-ylmethylamino)-6-(2,2,2-trifluoroethylamino)-1,3,5-triazin-2-yl]hydroxylamine.
| Compound Name | N-[4-(pyridin-3-ylmethylamino)-6-(2,2,2-trifluoroethylamino)-1,3,5-triazin-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 134108507 |
| Molecular Formula | C11H12F3N7O |
| Molecular Weight | 315.26 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | N-[4-(pyridin-3-ylmethylamino)-6-(2,2,2-trifluoroethylamino)-1,3,5-triazin-2-yl]hydroxylamine |
| SMILES | ONc1nc(NCc2cccnc2)nc(NCC(F)(F)F)n1 |
| InChI | InChI=1S/C11H12F3N7O/c12-11(13,14)6-17-9-18-8(19-10(20-9)21-22)16-5-7-2-1-3-15-4-7/h1-4,22H,5-6H2,(H3,16,17,18,19,20,21) |
| InChIKey | HTCFZCIMWWRFIW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|