C18H16F5N3O2 — CID 134109464
1-amino-3-(3,5-difluoro-4-hept-1-ynylphenyl)-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 134109464) has the molecular formula C18H16F5N3O2 and a molecular weight of 401.34 g/mol. Its IUPAC name is 1-amino-3-(3,5-difluoro-4-hept-1-ynylphenyl)-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 1-amino-3-(3,5-difluoro-4-hept-1-ynylphenyl)-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134109464 |
| Molecular Formula | C18H16F5N3O2 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 1-amino-3-(3,5-difluoro-4-hept-1-ynylphenyl)-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | CCCCCC#Cc1c(F)cc(-n2c(=O)cc(C(F)(F)F)n(N)c2=O)cc1F |
| InChI | InChI=1S/C18H16F5N3O2/c1-2-3-4-5-6-7-12-13(19)8-11(9-14(12)20)25-16(27)10-15(18(21,22)23)26(24)17(25)28/h8-10H,2-5,24H2,1H3 |
| InChIKey | ONAHDVZEANQWEG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|