C17H19F5 — CID 170854926
1-(1,1-difluorodec-3-ynyl)-4-(trifluoromethyl)benzene (PubChem CID 170854926) has the molecular formula C17H19F5 and a molecular weight of 318.33 g/mol. Its IUPAC name is 1-(1,1-difluorodec-3-ynyl)-4-(trifluoromethyl)benzene.
| Compound Name | 1-(1,1-difluorodec-3-ynyl)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 170854926 |
| Molecular Formula | C17H19F5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1-(1,1-difluorodec-3-ynyl)-4-(trifluoromethyl)benzene |
| SMILES | CCCCCCC#CCC(F)(F)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H19F5/c1-2-3-4-5-6-7-8-13-16(18,19)14-9-11-15(12-10-14)17(20,21)22/h9-12H,2-6,13H2,1H3 |
| InChIKey | UCGXGHQMWNVHKA-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|