C18H23F3O — CID 170548876
11-[4-(trifluoromethyl)phenyl]undec-10-yn-5-ol (PubChem CID 170548876) has the molecular formula C18H23F3O and a molecular weight of 312.37 g/mol. Its IUPAC name is 11-[4-(trifluoromethyl)phenyl]undec-10-yn-5-ol.
| Compound Name | 11-[4-(trifluoromethyl)phenyl]undec-10-yn-5-ol |
|---|---|
| PubChem CID | 170548876 |
| Molecular Formula | C18H23F3O |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 11-[4-(trifluoromethyl)phenyl]undec-10-yn-5-ol |
| SMILES | CCCCC(O)CCCCC#Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H23F3O/c1-2-3-9-17(22)10-7-5-4-6-8-15-11-13-16(14-12-15)18(19,20)21/h11-14,17,22H,2-5,7,9-10H2,1H3 |
| InChIKey | PCTJOMPGSXECGG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|