C27H30F3NO3 — CID 67187816
2-[(4-oct-1-ynylphenyl)methyl-[1-[4-(trifluoromethyl)phenyl]propyl]amino]-2-oxoacetic acid (PubChem CID 67187816) has the molecular formula C27H30F3NO3 and a molecular weight of 473.54 g/mol. Its IUPAC name is 2-[(4-oct-1-ynylphenyl)methyl-[1-[4-(trifluoromethyl)phenyl]propyl]amino]-2-oxoacetic acid.
| Compound Name | 2-[(4-oct-1-ynylphenyl)methyl-[1-[4-(trifluoromethyl)phenyl]propyl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 67187816 |
| Molecular Formula | C27H30F3NO3 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 2-[(4-oct-1-ynylphenyl)methyl-[1-[4-(trifluoromethyl)phenyl]propyl]amino]-2-oxoacetic acid |
| SMILES | CCCCCCC#Cc1ccc(CN(C(=O)C(=O)O)C(CC)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C27H30F3NO3/c1-3-5-6-7-8-9-10-20-11-13-21(14-12-20)19-31(25(32)26(33)34)24(4-2)22-15-17-23(18-16-22)27(28,29)30/h11-18,24H,3-8,19H2,1-2H3,(H,33,34) |
| InChIKey | LVXWPMFLPBKSPE-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|