C33H34F3NO3 — CID 67188561
2-[[4-[2-(4-hexylphenyl)ethynyl]phenyl]methyl-[1-[4-(trifluoromethyl)phenyl]propyl]amino]-2-oxoacetic acid (PubChem CID 67188561) has the molecular formula C33H34F3NO3 and a molecular weight of 549.63 g/mol. Its IUPAC name is 2-[[4-[2-(4-hexylphenyl)ethynyl]phenyl]methyl-[1-[4-(trifluoromethyl)phenyl]propyl]amino]-2-oxoacetic acid.
| Compound Name | 2-[[4-[2-(4-hexylphenyl)ethynyl]phenyl]methyl-[1-[4-(trifluoromethyl)phenyl]propyl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 67188561 |
| Molecular Formula | C33H34F3NO3 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | 2-[[4-[2-(4-hexylphenyl)ethynyl]phenyl]methyl-[1-[4-(trifluoromethyl)phenyl]propyl]amino]-2-oxoacetic acid |
| SMILES | CCCCCCc1ccc(C#Cc2ccc(CN(C(=O)C(=O)O)C(CC)c3ccc(C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H34F3NO3/c1-3-5-6-7-8-24-9-11-25(12-10-24)13-14-26-15-17-27(18-16-26)23-37(31(38)32(39)40)30(4-2)28-19-21-29(22-20-28)33(34,35)36/h9-12,15-22,30H,3-8,23H2,1-2H3,(H,39,40) |
| InChIKey | NSKGURFCACDTAB-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|