C31H32F3NO2 — CID 91200759
[[3-[2-(4-hexylphenyl)ethynyl]phenyl]methyl-[[4-(trifluoromethyl)phenyl]methyl]amino] acetate (PubChem CID 91200759) has the molecular formula C31H32F3NO2 and a molecular weight of 507.60 g/mol. Its IUPAC name is [[3-[2-(4-hexylphenyl)ethynyl]phenyl]methyl-[[4-(trifluoromethyl)phenyl]methyl]amino] acetate.
| Compound Name | [[3-[2-(4-hexylphenyl)ethynyl]phenyl]methyl-[[4-(trifluoromethyl)phenyl]methyl]amino] acetate |
|---|---|
| PubChem CID | 91200759 |
| Molecular Formula | C31H32F3NO2 |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | [[3-[2-(4-hexylphenyl)ethynyl]phenyl]methyl-[[4-(trifluoromethyl)phenyl]methyl]amino] acetate |
| SMILES | CCCCCCc1ccc(C#Cc2cccc(CN(Cc3ccc(C(F)(F)F)cc3)OC(C)=O)c2)cc1 |
| InChI | InChI=1S/C31H32F3NO2/c1-3-4-5-6-8-25-11-13-26(14-12-25)15-16-27-9-7-10-29(21-27)23-35(37-24(2)36)22-28-17-19-30(20-18-28)31(32,33)34/h7,9-14,17-21H,3-6,8,22-23H2,1-2H3 |
| InChIKey | ONTGJFAOCPFSOY-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|