C31H32F3NO3 — CID 141168395
2-[[4-[2-(4-hexylphenyl)ethynyl]phenyl]methyl-[[2-(trifluoromethyl)phenyl]methyl]amino]oxyacetic acid (PubChem CID 141168395) has the molecular formula C31H32F3NO3 and a molecular weight of 523.60 g/mol. Its IUPAC name is 2-[[4-[2-(4-hexylphenyl)ethynyl]phenyl]methyl-[[2-(trifluoromethyl)phenyl]methyl]amino]oxyacetic acid.
| Compound Name | 2-[[4-[2-(4-hexylphenyl)ethynyl]phenyl]methyl-[[2-(trifluoromethyl)phenyl]methyl]amino]oxyacetic acid |
|---|---|
| PubChem CID | 141168395 |
| Molecular Formula | C31H32F3NO3 |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 2-[[4-[2-(4-hexylphenyl)ethynyl]phenyl]methyl-[[2-(trifluoromethyl)phenyl]methyl]amino]oxyacetic acid |
| SMILES | CCCCCCc1ccc(C#Cc2ccc(CN(Cc3ccccc3C(F)(F)F)OCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C31H32F3NO3/c1-2-3-4-5-8-24-11-13-25(14-12-24)15-16-26-17-19-27(20-18-26)21-35(38-23-30(36)37)22-28-9-6-7-10-29(28)31(32,33)34/h6-7,9-14,17-20H,2-5,8,21-23H2,1H3,(H,36,37) |
| InChIKey | PSDKEJADROMZCF-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|