C28H34F3NO4 — CID 141074526
2-[[4-(11-hydroxyundec-1-ynyl)phenyl]methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]oxyacetic acid (PubChem CID 141074526) has the molecular formula C28H34F3NO4 and a molecular weight of 505.58 g/mol. Its IUPAC name is 2-[[4-(11-hydroxyundec-1-ynyl)phenyl]methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]oxyacetic acid.
| Compound Name | 2-[[4-(11-hydroxyundec-1-ynyl)phenyl]methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]oxyacetic acid |
|---|---|
| PubChem CID | 141074526 |
| Molecular Formula | C28H34F3NO4 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 2-[[4-(11-hydroxyundec-1-ynyl)phenyl]methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]oxyacetic acid |
| SMILES | O=C(O)CON(Cc1ccc(C#CCCCCCCCCCO)cc1)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H34F3NO4/c29-28(30,31)26-17-15-25(16-18-26)21-32(36-22-27(34)35)20-24-13-11-23(12-14-24)10-8-6-4-2-1-3-5-7-9-19-33/h11-18,33H,1-7,9,19-22H2,(H,34,35) |
| InChIKey | YMEGUXLJUPYZCF-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|