C25H26F3NO3 — CID 69000901
2-oxo-2-[1-phenylnon-5-ynyl-[[4-(trifluoromethyl)phenyl]methyl]amino]acetic acid (PubChem CID 69000901) has the molecular formula C25H26F3NO3 and a molecular weight of 445.48 g/mol. Its IUPAC name is 2-oxo-2-[1-phenylnon-5-ynyl-[[4-(trifluoromethyl)phenyl]methyl]amino]acetic acid.
| Compound Name | 2-oxo-2-[1-phenylnon-5-ynyl-[[4-(trifluoromethyl)phenyl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 69000901 |
| Molecular Formula | C25H26F3NO3 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 2-oxo-2-[1-phenylnon-5-ynyl-[[4-(trifluoromethyl)phenyl]methyl]amino]acetic acid |
| SMILES | CCCC#CCCCC(c1ccccc1)N(Cc1ccc(C(F)(F)F)cc1)C(=O)C(=O)O |
| InChI | InChI=1S/C25H26F3NO3/c1-2-3-4-5-6-10-13-22(20-11-8-7-9-12-20)29(23(30)24(31)32)18-19-14-16-21(17-15-19)25(26,27)28/h7-9,11-12,14-17,22H,2-3,6,10,13,18H2,1H3,(H,31,32) |
| InChIKey | SBPSVGLUQMBSFQ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|