C34H34F3NO4 — CID 77490735
2-hydroxy-5-[1-phenylundec-5-ynyl-[3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]benzoic acid (PubChem CID 77490735) has the molecular formula C34H34F3NO4 and a molecular weight of 577.64 g/mol. Its IUPAC name is 2-hydroxy-5-[1-phenylundec-5-ynyl-[3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]benzoic acid.
| Compound Name | 2-hydroxy-5-[1-phenylundec-5-ynyl-[3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 77490735 |
| Molecular Formula | C34H34F3NO4 |
| Molecular Weight | 577.64 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | 2-hydroxy-5-[1-phenylundec-5-ynyl-[3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]benzoic acid |
| SMILES | CCCCCC#CCCCC(c1ccccc1)N(C(=O)C=Cc1cccc(C(F)(F)F)c1)c1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C34H34F3NO4/c1-2-3-4-5-6-7-8-12-18-30(26-15-10-9-11-16-26)38(28-20-21-31(39)29(24-28)33(41)42)32(40)22-19-25-14-13-17-27(23-25)34(35,36)37/h9-11,13-17,19-24,30,39H,2-5,8,12,18H2,1H3,(H,41,42) |
| InChIKey | OYTGKCWHXGZCDP-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.64 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|