C20H15F6NO3 — CID 123524284
2-methyl-4-[3-oxo-3-[[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]amino]prop-1-enyl]benzoic acid (PubChem CID 123524284) has the molecular formula C20H15F6NO3 and a molecular weight of 431.33 g/mol. Its IUPAC name is 2-methyl-4-[3-oxo-3-[[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]amino]prop-1-enyl]benzoic acid.
| Compound Name | 2-methyl-4-[3-oxo-3-[[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]amino]prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 123524284 |
| Molecular Formula | C20H15F6NO3 |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 2-methyl-4-[3-oxo-3-[[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]amino]prop-1-enyl]benzoic acid |
| SMILES | Cc1cc(C=CC(=O)NC(c2cccc(C(F)(F)F)c2)C(F)(F)F)ccc1C(=O)O |
| InChI | InChI=1S/C20H15F6NO3/c1-11-9-12(5-7-15(11)18(29)30)6-8-16(28)27-17(20(24,25)26)13-3-2-4-14(10-13)19(21,22)23/h2-10,17H,1H3,(H,27,28)(H,29,30) |
| InChIKey | SYMPIJIOYFVXEO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|