C18H12F6N2O3 — CID 86653069
(E)-3-(3-nitrophenyl)-N-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]prop-2-enamide (PubChem CID 86653069) has the molecular formula C18H12F6N2O3 and a molecular weight of 418.29 g/mol. Its IUPAC name is (E)-3-(3-nitrophenyl)-N-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3-nitrophenyl)-N-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 86653069 |
| Molecular Formula | C18H12F6N2O3 |
| Molecular Weight | 418.29 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | (E)-3-(3-nitrophenyl)-N-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)NC(c1cccc(C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C18H12F6N2O3/c19-17(20,21)13-5-2-4-12(10-13)16(18(22,23)24)25-15(27)8-7-11-3-1-6-14(9-11)26(28)29/h1-10,16H,(H,25,27)/b8-7+ |
| InChIKey | MRYPQNZQWZMSHU-BQYQJAHWSA-N |
| XLogP | 5.05 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.29 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|