C19H12BrF6NO3 — CID 87305727
2-bromo-4-[(E)-3-oxo-3-[[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]amino]prop-1-enyl]benzoic acid (PubChem CID 87305727) has the molecular formula C19H12BrF6NO3 and a molecular weight of 496.20 g/mol. Its IUPAC name is 2-bromo-4-[(E)-3-oxo-3-[[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]amino]prop-1-enyl]benzoic acid.
| Compound Name | 2-bromo-4-[(E)-3-oxo-3-[[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]amino]prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 87305727 |
| Molecular Formula | C19H12BrF6NO3 |
| Molecular Weight | 496.20 g/mol |
| Exact Mass | 494.99 |
| IUPAC Name | 2-bromo-4-[(E)-3-oxo-3-[[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]amino]prop-1-enyl]benzoic acid |
| SMILES | O=C(/C=C/c1ccc(C(=O)O)c(Br)c1)NC(c1cccc(C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C19H12BrF6NO3/c20-14-8-10(4-6-13(14)17(29)30)5-7-15(28)27-16(19(24,25)26)11-2-1-3-12(9-11)18(21,22)23/h1-9,16H,(H,27,28)(H,29,30)/b7-5+ |
| InChIKey | QVTXXENKVIKLLJ-FNORWQNLSA-N |
| XLogP | 5.60 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.20 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|