C23H16F12N4O2 — CID 71819571
(E)-3-[4-[(E)-(2,2,2-trifluoroethylcarbamoylhydrazinylidene)methyl]-3-(trifluoromethyl)phenyl]-N-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]prop-2-enamide (PubChem CID 71819571) has the molecular formula C23H16F12N4O2 and a molecular weight of 608.38 g/mol. Its IUPAC name is (E)-3-[4-[(E)-(2,2,2-trifluoroethylcarbamoylhydrazinylidene)methyl]-3-(trifluoromethyl)phenyl]-N-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-[4-[(E)-(2,2,2-trifluoroethylcarbamoylhydrazinylidene)methyl]-3-(trifluoromethyl)phenyl]-N-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 71819571 |
| Molecular Formula | C23H16F12N4O2 |
| Molecular Weight | 608.38 g/mol |
| Exact Mass | 608.11 |
| IUPAC Name | (E)-3-[4-[(E)-(2,2,2-trifluoroethylcarbamoylhydrazinylidene)methyl]-3-(trifluoromethyl)phenyl]-N-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(/C=N/NC(=O)NCC(F)(F)F)c(C(F)(F)F)c1)NC(c1cccc(C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C23H16F12N4O2/c24-20(25,26)11-36-19(41)39-37-10-14-6-4-12(8-16(14)22(30,31)32)5-7-17(40)38-18(23(33,34)35)13-2-1-3-15(9-13)21(27,28)29/h1-10,18H,11H2,(H,38,40)(H2,36,39,41)/b7-5+,37-10+ |
| InChIKey | FUMRRKXLSHBQKJ-YUFUDMMXSA-N |
| XLogP | 6.35 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.38 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|