C29H35Cl2NO3 — CID 67187475
2-[(4-dec-1-ynylphenyl)methyl-[2-(3,4-dichlorophenyl)butyl]amino]-2-oxoacetic acid (PubChem CID 67187475) has the molecular formula C29H35Cl2NO3 and a molecular weight of 516.51 g/mol. Its IUPAC name is 2-[(4-dec-1-ynylphenyl)methyl-[2-(3,4-dichlorophenyl)butyl]amino]-2-oxoacetic acid.
| Compound Name | 2-[(4-dec-1-ynylphenyl)methyl-[2-(3,4-dichlorophenyl)butyl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 67187475 |
| Molecular Formula | C29H35Cl2NO3 |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | 2-[(4-dec-1-ynylphenyl)methyl-[2-(3,4-dichlorophenyl)butyl]amino]-2-oxoacetic acid |
| SMILES | CCCCCCCCC#Cc1ccc(CN(CC(CC)c2ccc(Cl)c(Cl)c2)C(=O)C(=O)O)cc1 |
| InChI | InChI=1S/C29H35Cl2NO3/c1-3-5-6-7-8-9-10-11-12-22-13-15-23(16-14-22)20-32(28(33)29(34)35)21-24(4-2)25-17-18-26(30)27(31)19-25/h13-19,24H,3-10,20-21H2,1-2H3,(H,34,35) |
| InChIKey | RGNRYHBJLPTABT-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|