C16H13F3O2 — CID 134109996
1-(2-hydroxyphenyl)-3-[4-(trifluoromethyl)phenyl]propan-1-one (PubChem CID 134109996) has the molecular formula C16H13F3O2 and a molecular weight of 294.27 g/mol. Its IUPAC name is 1-(2-hydroxyphenyl)-3-[4-(trifluoromethyl)phenyl]propan-1-one.
| Compound Name | 1-(2-hydroxyphenyl)-3-[4-(trifluoromethyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 134109996 |
| Molecular Formula | C16H13F3O2 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1-(2-hydroxyphenyl)-3-[4-(trifluoromethyl)phenyl]propan-1-one |
| SMILES | O=C(CCc1ccc(C(F)(F)F)cc1)c1ccccc1O |
| InChI | InChI=1S/C16H13F3O2/c17-16(18,19)12-8-5-11(6-9-12)7-10-15(21)13-3-1-2-4-14(13)20/h1-6,8-9,20H,7,10H2 |
| InChIKey | WMSIOAOVCZKJQU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |