C8H6Cl4 — CID 13411
1,2,4,5-tetrachloro-3,6-dimethylbenzene (PubChem CID 13411) has the molecular formula C8H6Cl4 and a molecular weight of 243.95 g/mol. Its IUPAC name is 1,2,4,5-tetrachloro-3,6-dimethylbenzene.
| Compound Name | 1,2,4,5-tetrachloro-3,6-dimethylbenzene |
|---|---|
| PubChem CID | 13411 |
| Molecular Formula | C8H6Cl4 |
| Molecular Weight | 243.95 g/mol |
| Exact Mass | 241.92 |
| IUPAC Name | 1,2,4,5-tetrachloro-3,6-dimethylbenzene |
| SMILES | Cc1c(Cl)c(Cl)c(C)c(Cl)c1Cl |
| InChI | InChI=1S/C8H6Cl4/c1-3-5(9)7(11)4(2)8(12)6(3)10/h1-2H3 |
| InChIKey | CTSQZGJZQUVGBQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.95 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|