C17H23N2O7P — CID 134110040
2-(2-methoxyphenoxy)-N-methyl-N-(2-pyridin-2-ylethyl)acetamide;phosphoric acid (PubChem CID 134110040) has the molecular formula C17H23N2O7P and a molecular weight of 398.35 g/mol. Its IUPAC name is 2-(2-methoxyphenoxy)-N-methyl-N-(2-pyridin-2-ylethyl)acetamide;phosphoric acid.
| Compound Name | 2-(2-methoxyphenoxy)-N-methyl-N-(2-pyridin-2-ylethyl)acetamide;phosphoric acid |
|---|---|
| PubChem CID | 134110040 |
| Molecular Formula | C17H23N2O7P |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 2-(2-methoxyphenoxy)-N-methyl-N-(2-pyridin-2-ylethyl)acetamide;phosphoric acid |
| SMILES | COc1ccccc1OCC(=O)N(C)CCc1ccccn1.O=P(O)(O)O |
| InChI | InChI=1S/C17H20N2O3.H3O4P/c1-19(12-10-14-7-5-6-11-18-14)17(20)13-22-16-9-4-3-8-15(16)21-2;1-5(2,3)4/h3-9,11H,10,12-13H2,1-2H3;(H3,1,2,3,4) |
| InChIKey | UFBNCHKSLGFJNU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 129.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|